| 1 | Author
| Gudrun Stieglitz, Bernhard Neumüller, K. Urt Dehnicke | Requires cookie* | | Title
| Synthesen und Kristallstrukturen der Lithiumphosphide { Li(DME)[P(f-Bu)2]} 2 und [Li(DM E)PPh2l00 Syntheses and Crystal Structures of the Lithium Phosphides {Li(DME)[P(/-Bu)2]}2 and [Li(DM E)PPh2]0 0  | | | Abstract
| The title com pounds have been prepared by the reaction o f rc-butyllithium with the corre sponding diorganophosphanes H PR 2 (R = r-Bu, Ph) in D M E solutions. Both compounds were characterized by crystal structure determinations. {Li(DM E)[P(f-Bu)2]}2: Space group P 1, Z = 1, 2027 observed unique reflections, R = 0.055. Lattice dimensions at —80 °C: a = 879.9(3), b = 986.3(1), c = 1064.0(2) pm, a = 70.69(1)°, ß = 70.63(2)°, y -69.89(2)°. The com pound forms centrosymmetric dimers o f symmetry Q with L i-P bond lengths o f 260.0 and 257.3 pm for the Li2P2 four-membered ring. [Li(DM E)PPh2]0C : Space group P 2 ,/«, Z = 4. 3437 observed unique reflections, R = 0.055. Lattice dimensions at -8 0 °C: a = 1034.8(2), b = 812.48(9), c = 1978.4(3) pm, ß = 103.30(2)°. The com pound forms polymeric chains via LiP bridges with L i-P bond lengths o f 256.3 and 254.1 pm. | | |
Reference
| Z. Naturforsch. 48b, 156 (1993); eingegangen am 8. Oktober 1992 | | |
Published
| 1993 | | |
Keywords
| Lithium Phosphides, Synthesis, Crystal Structure | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/48/ZNB-1993-48b-0156.pdf | | | Identifier
| ZNB-1993-48b-0156 | | | Volume
| 48 | |
2 | Author
| Jorge Blanco, Eduardo Gayoso, JoseManuel Vila, Miguel Gayoso, CäciliaM. Aichle, -. M. Össmer, Joachim Strähle | Requires cookie* | | Title
| Synthesis and Structure of Di-I/i-acetato(0,0')-ferrocenylmethyliden- 2,4,6-trimethylaniline(N,C)-palladium(II)l  | | | Abstract
| Di-[//-acetato(0,0')-ferrocenylmethylidene-2,4,6-trimethylaniline(N,C)-palladium(II)], | | |
Reference
| Z. Naturforsch. 48b, 906—910 (1993); received M arch 8 1993 | | |
Published
| 1993 | | |
Keywords
| Cyclometallation, Synthesis, Crystal Structure | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/48/ZNB-1993-48b-0906.pdf | | | Identifier
| ZNB-1993-48b-0906 | | | Volume
| 48 | |
4 | Author
| Adalbert Lossin, Gerd Meyer | Requires cookie* | | Title
| CsPr2(CH3COO)7, ein caesiumarmes wasserfreies ternäres Caesium-Praseodym-Acetat CsPr2(C H 3COO)7, a Cesium Poor Anhydrous Ternary Cesium Praseodymium (III) Acetate  | | | Abstract
| Single crystals of CsPr2(CH 3CO O)7 were obtained from an acetic acid solution of Pr(CH 3COO)3-H-,0 and C s ^ O j in a m olar ratio of 4:1 at 120 °C. It crystallizes in the triclinic system', PT (no. 2), Z = 2, a = 1028.1(5), b = 1034.6(5), c = 1199.4(6) pm, a = 84.82(2), ß = 67.07(3), y = 76.01(2)°, Vm = 343.3(3) cm3/mol, R = 0.031, R w = 0.027. The crystal structure contains infinite chains, i[P r2(CH 3COO)6], running along the [1 1 0] direction. The chains are built up by bridging acetate ions coordinated to two crystallographically different P r3+ ions which are both surrounded by 9 oxygen ligands. These chains are linked by "intercalated" Cs(CH3COO) to layers parallel (100). C s+ has contacts to oxygen atoms of neighbouring layers, such that a three-dimensional network is formed. | | |
Reference
| Z. Naturforsch. 48b, 886—892 (1993); eingegangen am 8. M ärz 1993 | | |
Published
| 1993 | | |
Keywords
| Cesium Praseodym Acetate, Synthesis, Crystal Structure | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/48/ZNB-1993-48b-0886.pdf | | | Identifier
| ZNB-1993-48b-0886 | | | Volume
| 48 | |
5 | Author
| Blaschette Arm, Karl-Heinz Nagel, PeterG. Jones | Requires cookie* | | Title
| Polysulfonylamine, XLIV [1] Synthese von |Na(15-Krone-5)][N(S02CH3)2l und Kristallstruktur bei -9 5 °C Polysulfonylamines, XLIV [1] Synthesis of [Na(15-Crown-5)][N(S02C H 3)2] and Crystal Structure at -9 5 °C  | | | Abstract
| The complex [Na(15-crown-5)][N(S02C H 3)2] crystallizes at -2 5 °C from a methanol solu tion containing equimolar am ounts of N aN (S 0 2C H 3)2 and 15-crown-5. Its crystallographic data at -9 5 °C are: monoclinic, space group P2,/c, a = 852.1(5), b = 2731.9(12), c = 909.2(4) pm, ß = 115.53(4)°, V = 1.910 nm3, Z = 4, D v = 1.445 M gm 3. The structure in the solid state consists of ion pairs. The sodium cation is coordinated to the five oxygen atoms of the crown ether, one oxygen atom o f the anion, and to the nitrogen atom of the anion. The bond distances are N a-O (crow n) 238.7-247.2, Na sodium ion lies 78 pm out of the plane o f the crown the coronand is described. | | |
Reference
| Z. Naturforsch. 48b, 893—897 (1993); eingegangen am 5. Februar 1993 | | |
Published
| 1993 | | |
Keywords
| Polysulfonylamines, (15-Crown-5)sodium Dimesylamide, Synthesis, Crystal Structure | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/48/ZNB-1993-48b-0893.pdf | | | Identifier
| ZNB-1993-48b-0893 | | | Volume
| 48 | |
6 | Author
| Michael Plate, Peter Hofacker, WernerM. Assa, Birgit Schwarz, Bernhard Neumüller, Kurt Dehnicke | Requires cookie* | | Title
| Synthese und Kristallstrukturen der Wolfram(VI)-Alkinkomplexe |WCl4(P h -C = C -I)(T H F )l und [WCl4( P h -C = C -T e -C 4H9)(THF)| Synthesis and Crystal Structures o f the Tungsten(VI) Alkyne Complexes [WCl4(P h -C = C -I)(T H F )] and [WCl4( P h -C = C -T e -C 4H 9)(THF)]  | | | Abstract
| [WCl4(P h -C = C -I)(T H F)] has been prepared by the reaction o f mrns-[WCl4(SEt2)2] with P h -C = C -I in TH F solution, whereas [WCl4(P h -C = C -T e -n C 4H 9)(THF)] has been syn thesized by the reaction o f P h -C = C -T e -« C 4H 9 with tungsten hexacloride in the presence o f C2C14 and THF. Both complexes were characterized by IR spectroscopy and by crystal struc ture determinations. [WCl4(P h -C = C -I)(T H F)]: Space group P 2,/c, Z = 4, 2617 observed unique reflections, R = 0.064. Lattice dimensions at -7 0 °C: a = 1518.2(3), b = 714.5(1), c = 1540.0(3) pm, ß = 90.09(3)°. [WCl4(P h -C = C -T e -« C 4H9)(TH F)]. Space group P 1, Z = 2, 3911 observed unique reflec tions, R = 0.067. Lattice dimensions at 20 °C: a = 844.0(3), b = 974.6(4), c = 1002.4(3) pm, a = 76.00(4),/? = 105.14(1), y = 82.03(3)°. Both complexes have molecular structures, in which the tungsten atom s are seven-coordi nate by four chlorine ligands, by the two alkyne carbon atom s, and in trans position to the latter by the oxygen atom o f the T H F molecule. The WC bond lengths are 198 and 200(1) in the telluro complex and 206 and 196(1) pm in the iodine derivative. | | |
Reference
| Z. Naturforsch. 48b, 1105—1111 (1993); eingegangen am 21. April 1993 | | |
Published
| 1993 | | |
Keywords
| Tungsten Alkyne Complexes, Synthesis, IR Spectra, Crystal Structure | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/48/ZNB-1993-48b-1105.pdf | | | Identifier
| ZNB-1993-48b-1105 | | | Volume
| 48 | |
7 | Author
| Herrn Prof, Dr | Requires cookie* | | Title
| Zur Struktur des Pentaazadienidions [tol-N =N -N -N =N -tol]  | | | Abstract
| _. Synthese und Kristallstruktur von Cs2(18-Krone-6)(tolN5tol)2 und (NH4)[Cr(NH3)6(H20) 4](tolN5tol)4 T h e S tru c tu re o f th e P e n ta a z a d ie n id e A n io n [ to l-N = N -N -N = N -to l] _. S yn th esis a n d C ry sta l S tru c tu re o f C s2(1 8 -C ro w n -6)(to lN 5to l)2 an d (N H 4)[C r(N H 3)6(H 20) 4] (to lN 5to l)4 S u san n e D ie te ric h , Jo a c h im S träh le* A concentrated solution of CsCl, 18-crown-6, and to l-N = N -N (H)-N = N -to l in aqueous am m onia affords Cs2(18-crown-6)(tolN5tol)2, which crystallizes in the triclinic space group P 1 with a = 852.6(2), b = 1139.4(3), c -1373.9(4) pm, a = 104.17(3),ß = 95.94(2), y = 110.74(2)°, Z = 1. In the structure centrosym m etrical [Cs2(18-crown-6)]2+ moieties are packed with pairs of l,5-bis(tolyl)pentaazadienide anions to built up columns along [100]. The N -N distances N 1 -N 2 = 128 pm and N 4 -N 5 = 129 pm in the pentaazadienide anions indicate localized double bonds, while the distances N 2 -N 3 and N 3 -N 4 of 134 pm can be assigned to single bonds. A m ixture of C r(N H 3)^+ and tolN N N (H)N N tol in concentrated aqueous am monia yields triclinic (N H 4)[C r(N H 3)6(H 20) 4](tolN 5tol)4 crystallizing in the space group P 1 with the lattice param eters a = 1561.1(1), b = 1619.3(3), c = 1703.3(2) pm, a = 107.03(1), ß = 116.81(1), y = 101.75(1)°, Z = 2. The structure contains tolN5toh anions, NH^ cations and [C r(N H 3)6(H 2Ö)4]3+ complexes in which four triangular faces of the Cr(N H 3)6 octahedron are capped by w ater molecules which are linked via hydrogen bonds. Within the pentaazadienide anions which are connected with the [Cr(N H 3)6(H 20) 4]3+ complexes also via hydrogen bonds an indication for localized double bonds N 1=N2 and N 4=N 5 has been obtained. | | |
Reference
| Z. Naturforsch. 48b, 1574—1580 (1993); eingegangen am 26. Juli 1993 | | |
Published
| 1993 | | |
Keywords
| Pentaazadienide A nion, Synthesis, Crystal Structure | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/48/ZNB-1993-48b-1574.pdf | | | Identifier
| ZNB-1993-48b-1574 | | | Volume
| 48 | |
9 | Author
| Z. A. Fokina, V. I. Pekhnyo, S. V. Volkov, V. F. Lapko, Y. V. Bryukhova, S. I. Kuznetsov | Requires cookie* | | Title
| Cl NQR Spectra of Some New Iridium Chlorochalcogenide Complexes  | | | Abstract
| The 35C1 N Q R spectra of the chlorochalcogenide complexes of iridium (SC13)2 [IrCl6] 1, (TeCl3)2 [IrCl6] 2, (SeCl3) [IrCl6] 3, [IrC l^ S C l,)^ 4, (SC13) [IrCl4(SCl2)2] 5 and [IrCl3(SeCl2)2]2 6 have been studied. The spectra were recorded by pulse spectrometry. They consist of two mul tiplets, widely separated in frequency. The high-frequency multiplet belongs to the chlorine atom s bonded to sulfur, selenium and tellurium, respectively, in the ligand. A high-frequency shift is observed, which is typical for the coordination of the molecules AC12(A = S, Se) and AC14(A = S, Se, Te). The low frequencies in the multiplets o f 4 and 6 are attributed to addition al bonds formed between chalcogen atom and chlorine in the coordination environment of iridium. In the spectral region 18-24 MHz lie the N Q R frequencies of 35C1 bonded to iridium. For 2 the frequencies are close to those of [IrCl6]2-, which confirms the Ir oxidation state IV. The unexpectedly high frequencies for Ir111 in the case of 4 and 5 are explained by the influence of AC12 molecules, which are weaker er-donors than the chloro ligands. This prom otes electron density transfer from neighbouring chlorine atoms. The 18 M Hz frequency is assigned to the bridge chlorine atoms in dimeric molecule 4. This assignment is confirmed by the positive value of d v /d T = +0,2. | | |
Reference
| Z. Naturforsch. 48b, 986—990 (1993); received July 14 1992 | | |
Published
| 1993 | | |
Keywords
| Iridium (III, IV ), Chlorochalcogenide Complexes, Synthesis, N Q R Spectra | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/48/ZNB-1993-48b-0986.pdf | | | Identifier
| ZNB-1993-48b-0986 | | | Volume
| 48 | |
12 | Author
| Henning Von Arnim, Kurt Dehnicke, Klaus Maczek, D. Ieter Fenske | Requires cookie* | | Title
| Ionische Kronenetherkomplexe von Thallium(I), Blei(II) und Indium(III). Die Kristallstrukturen von [Tl(12-Krone-4)2][SbCl6], [Pb(15-Krone-5)2][SbCl6]2* [SbCl3(15-Krone-5>] und [In(12-Krone-4)2][SbCl6]3* 3 CH3CN  | | | Abstract
| Ionic Crown E ther Complexes of Thallium(I), Lead(II), and Indium(III). Crystal Structures of [Tl(12-Crown-4)2][SbCl6], [Pb(15-Crown-5)2][SbCl6]2-[SbCl3(15-Crown-5)], and [In(12-Crown-4)2][SbCl6]3 -3 CH3CN T he ionic crown ether com plexes [Tl(12-crown-4)2][SbCl6] (1) and [In(12-crown-4)2][SbCl6]3-3 C H 3CN (3) have been prepared by reaction o f T1C1 and InCl3, respectively, with SbCl5 in the presence o f 12-crown-4 in acetonitrile solution. The lead com | | |
Reference
| Z. Naturforsch. 48b, 1331 (1993); eingegangen am 3. Juni 1993 | | |
Published
| 1993 | | |
Keywords
| Ionic Crown Ether Com plexes o f Thallium, Lead, Indium, Synthesis, Crystal Structure | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/48/ZNB-1993-48b-1331.pdf | | | Identifier
| ZNB-1993-48b-1331 | | | Volume
| 48 | |
13 | Author
| Hans Wolkers, Ralf Stegmann, G. Ernot, Frenking, Kurt Dehnicke, D. Ieter Fenske, G.Erhard Baum | Requires cookie* | | Title
| Das Methylviologen-Radikalkation. Synthese, Kristallstruktur und ab Rechnungen von N,N'-Dimethyl-4,4'-bipyridinium-chlorid-dihydrat The Methylviologen Radical Cation. Synthesis, Crystal Structure and ab initio Calculations of N,N' -Dimethyl-4,4'-bipyridinium Chloride Dihydrate  | | | Abstract
| The title compound has been prepared by the reduction of N,N'-dimethyl-4,4'-bipyridinium dichloride with dilithium tritelluride in dimethylformamide solution. It forms deep blue crystal needles, which were characterized by a crystal structure determination. Space group Pna21; Z -8, 3450 observed unique reflections, R = 0.045. Lattice dimensions at -70 °C: a = 1707.6(8), b = 2323.9(11), c -664.6(3) pm. The N,N'-dimethyl-4,4'-bipyridinium radical cations are planar and form ion pairs in the lattice. The chloride ions together with the water molecules form an infinite network of hydrogen bridges along the crystallographic «-axis. The structural parameters of the radical cation are in excellent agreement with ab initio calculations. | | |
Reference
| Z. Naturforsch. 48b, 1341—1347 (1993); eingegangen am 25. Juni 1993 N | | |
Published
| 1993 | | |
Keywords
| N'-Dimethyl-4, 4'-bipyridinium Chloride Dihydrate, Synthesis, Crystal Structure | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/48/ZNB-1993-48b-1341.pdf | | | Identifier
| ZNB-1993-48b-1341 | | | Volume
| 48 | |
14 | Author
| A. Asam, B. Janssen, G. Hüttner, L. Zsolnai, O. W. Alter | Requires cookie* | | Title
| tripod-Eisen-und rri/?o*/-Cobalt-Komplexe mit Acetonitril als Stützliganden {tripod = RCH2C(CH2PPh2)3; R = H, Ph) tripod-Iron and m pod-Cobalt-Complexes with Acetonitrile as Supporting Ligands (tripod = RCH2C(CH2PPh2)3; R = H, Ph)  | | | Abstract
| The tripod ligands R C H ,C (C H 2 PPh2) 3 react with (C H 3 CN)6Fe(BF4) 2 to yield the | | |
Reference
| Z. Naturforsch. 48b, 1707—1714 (1993); eingegangen am 29. Juli 1993 | | |
Published
| 1993 | | |
Keywords
| T ripod Ligands, Iron Complexes, Cobalt Complexes, Synthesis, Structure | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/48/ZNB-1993-48b-1707.pdf | | | Identifier
| ZNB-1993-48b-1707 | | | Volume
| 48 | |
15 | Author
| Hermann Irngartingera, Jochen Lichtenthälera, Dieter Fenskeb, Gerhard Baumb | Requires cookie* | | Title
| Synthesen und Strukturen von 2,5-Bis(2-arylvinyl)-l,4-benzochinonen und deren photochemisches Verhalten im Kristall Syntheses and Crystal Structures of 2,5-Bis(2-arylvinyl)-l,4-benzoquinones and their Photochemical Reactivity in the Crystalline State  | | |
Reference
| Z. Naturforsch. 48b, 1411—1418 (1993); eingegangen am 14. Mai 1993 | | |
Published
| 1993 | | |
Keywords
| 2, 5-D istyryl-l, 4-benzoquinones, Synthesis, Crystal Structure, Solid State Photochemistry | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/48/ZNB-1993-48b-1411.pdf | | | Identifier
| ZNB-1993-48b-1411 | | | Volume
| 48 | |
16 | Author
| Jörn Müller, Ke Qiao, Regina Schubert, M. Atthias Tschampel | Requires cookie* | | Title
| ;r-01efin-Iridium-Komplexe, XVIII [1] Reaktionen von Bis[cycloocta-l,5-dien-//-chloro-iridium] mit w-Propyllithium in Gegenwart von Alkinen yr-Olefin Iridium Complexes, XVIII [1] Reactions of Bis[cycloocta-l,5-diene-/z-chloro-iridium] with n -Propyllithium in the Presence of Alkynes  | | | Abstract
| The reaction of [(cod)IrCl]2 (cod = //4-cycloocta-l,5-diene) with n-C3H7Li gives non-isola-ble (cod)IrH species by /3-elimination of (cod)Ir-n-C3H7 intermediates; the stable final prod ucts of further reactions with RC = CR highly depend on the nature of the substituents R. With R = Me the 6-endo-H-hexamethylcyclohexadienyl complex 1 is obtained together with the iridacyclopentadienyl compound 2 and known }[(cod)IrH]4C3H4} (3). In case of R = Et steric effects cause transfer of the hydridic hydrogen to the cod ligand, and the hexaethyl-benzene species 4 is isolated which was characterized by crystal structure analysis. The reac tion system with tolane again yields a 6-enJo-H-cyclohexadienyl complex (5). In all cases free substituted benzenes are formed as cyclotrimerization products of the alkynes. | | |
Reference
| Z. Naturforsch. 48b, 1558—1564 (1993); eingegangen am 15. Juli 1993 | | |
Published
| 1993 | | |
Keywords
| Substituted Benzene, Cyclohexadienyl and Iridacyclopentadienyl Complexes, Synthesis, NMR Spectra, Crystal Structure | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/48/ZNB-1993-48b-1558.pdf | | | Identifier
| ZNB-1993-48b-1558 | | | Volume
| 48 | |
|