| 3 | Author
| Henri Brunner, Manfred Muschiol, Wilfried Nowak | Requires cookie* | | Title
| Optisch aktive Übergangsmetall-Komplexe, LVII [1]  | | | Abstract
| (+)-und (—)-C5H5M(CO)(P02R*)X mit M = Fe, "Fe und X = 1, COCH3, CH3 Optically Active Transition Metal Complexes, LVII [1] (+)-and (—)-C5H5M(CO)(P02R*)X with M = Fe, "Fe, and X = I, COCH3, CH3 In the reaction of C5H5Fe(CO)2l and CsHsFefCO^CHa, respectively, with S-(+)-(C6H5)2PN(CH3)CH(CH3)(C6H5) (abbreviated P02R*) the complexes C5H5Fe(CO)(P02R*)I(l),C5H5Fe(CO)(P02R*)COCH3(2),andC5H5Fe(CO)(P02R !,t)CH3(3) are formed as pairs of diastereoisomers the components of which differ only in the configu-ration at the iron atom. CsH5Fe(CO)(P02R*)CH3 (3) can be obtained in higher yield by photochemical decarbonylation of C5H5Fe(CO)(P02R*)COCH3 (2). The (+)s85-and (—)365-diastereoisomers of each pair exhibit different chemical shifts in the X H NMR spectra. Diastereoisomer separation can be achieved by fractional crystallization. Starting with 57 Fe metal (—)365-C5H5 57 Fe(CO)(P02R*)I was prepared via 57 FeI2, 57 Fe(CO)4l2, C5H5 57 Fe(CO)2l, and C5H5 57 Fe(CO)(P02R*)I in order to demonstrate optical activity of a 57 Fe compound in the y region by Mössbauer polarimetry in later experiments to be reported elsewhere. | | |
Reference
| Z. Naturforsch. 33b, 407—411 (1978); eingegangen am 24. Januar 1978 | | |
Published
| 1978 | | |
Keywords
| Diastereoisomer Separation, X H NMR, Optical Activity, Transition Metal Complexes | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/33/ZNB-1978-33b-0407.pdf | | | Identifier
| ZNB-1978-33b-0407 | | | Volume
| 33 | |
5 | Author
| Henri Brunner, Heinz Vogt | Requires cookie* | | Title
| Optically Active Transition Metal Complexes, LIX [1]  | | | Abstract
| The pair of diastereoisomers (+)436-and (—)436-C5H5Fe(CO)(COCH3)P02R*, with P02R* = (S)-(+)-(C6H5)2PN(CH3)CH(CH3)(C6H5), can be separated into its components by preparative liquid chromatography under pressure. On heating (+)436-C5H5Fe(CO)-(COCH3)P02R* equilibrates with C5H5Fe(CO)2CH3 and P02R* before epimerization at the Fe [atom takes place. In the same way, the equilibrium C5H5Fe(CO)(COCH3)P(C6Hs)3 C5H5Fe(CO)2CH3 + P(C6Hs)3 can be obtained starting from either side. It is shown that the decarbonylation C5H5Fe(CO)(COCH3)P(C6H5)3 C5H5Fe(CO)(CH3)P(C6H5)3 + CO is not a thermal but a photochemical reaction. | | |
Reference
| Z. Naturforsch. 33b, 1231—234 (1978); eingegangen am 6. Juli 1978 | | |
Published
| 1978 | | |
Keywords
| Diastereoisomer Separation, Preparative Liquid Chromatography, 1 H NMR, Optical Activity, Transition Metal Complexes | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/33/ZNB-1978-33b-1231.pdf | | | Identifier
| ZNB-1978-33b-1231 | | | Volume
| 33 | |
|