| | 1 | Author
| Ekkehard Lindner, Günter Von Au | Requires cookie* | | | Title
| Darstellung und Eigenschaften von und Reaktionen mit metallhaltigen Heterocyclen, VII [1] Heterolytische Spaltung der Re-Re-Bindung in den Zweikern-Anionen [(OC)4ReP(R2 )0] 2 2 ~ mit Elektrophilen - ein Weg zu Heterocyclen mit Re-C-o-Bindung Preparation and Properties of, and Reactions with, Metal-Containing Heterocycles, VII [1] Heterolytic Cleavage of the Re-Re Bond in the Binuclear Anions [(0C)4ReP(R2)0]2 2_ with Electrophiles -a Pathway to Heterocycles with Re-C a Bonds  | | | | Abstract
| The preparation of the six-membered rhenacyclohexanes (OC)4ReP(R2)OCH2C(CH3)2CH2 (la, b) [R = CH3 (a), C6H5 (b)J is accomplished by heterolytic cleavage of the Re-Re bond in the binuclear anions [(0C)4ReP(R2)0]2 2 -with strong electrophiles like the alkane-diylbis(triflate) (CH3)2C(CH2Y)2 (Y= OSO2CF3), followed by an attack of the a>-positioned carbenium-like C atom on the phosphinite oxygen of the anion. 1 a, b insert SO2 under ring I I | | | |
Reference
| Z. Naturforsch. 35b, 1104—1110 (1980); eingegangen am 9. Mai 1980 | | | |
Published
| 1980 | | | |
Keywords
| Rhenacyclohexanes, Mechanism, S02-Insertio", X-ray, IR spectra, NMR spectra : | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/35/ZNB-1980-35b-1104.pdf | | | | Identifier
| ZNB-1980-35b-1104 | | | | Volume
| 35 | |
| 2 | Author
| K. Barlos, Heinrich Nöth | Requires cookie* | | | Title
| Beiträge zur Chemie des Bors, CVIII [1] Synthese und Konformation yon N.N'-Bis(boryl)-N.N'-dimethylhydrazinen Contributions to the Chemistry of Boron, CVIII [1] Synthesis and Conformation of N,N , -Bis(boryl)-N,N'-dimethylhydrazines N,N'-Bis(methylboryl)-N,N'-dimethyl-hydrazine, N,N'-Bis(dichlor-boryl)-N,N | | | |
Reference
| (Z. Naturforsch. 35b, 125—132 [1980]; eingegangen am 10. August 1979) | | | |
Published
| 1980 | | | |
Keywords
| -dimethyl-hydrazine, Conformation, NMR Spectra, PE Spectra | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/35/ZNB-1980-35b-0125.pdf | | | | Identifier
| ZNB-1980-35b-0125 | | | | Volume
| 35 | |
| 4 | Author
| Herbert Schumann, Manfred Meissner | Requires cookie* | | | Title
| Organometallphosphin-substituierte Übergangsmetallkomplexe, XXVI [1] Diearbonyl-nitrosyl-organometaUphosphin-kobalt-Komplexe Organometalphosphine-Substituted Transition Metal Complexes, XXVI [1] Dicarbonyl Nitrosjd Organometal Phosphine Cobalt Complexes | | | | Abstract
| The reactions of tricarbonyl nitrosyl cobalt with tri-feri-butylphosphine, di(teri-butyl)-trimethylsilyl-, -germyl-, -stannylphosphine, £er£-butyl-bis(trimethylsilyl)-, -(germyl)-, -(stannyl)phosphine, as well as with tris(trimethylsilyl)-, -(germyl)-, and -(stannyl-phosphine result in the elimination of one CO-ligand and the formation of corresponding dicarbonyl-nitrosyl-organometal phosphine cobalt complexes. The NMR spectra of the products are reported and discussed. | | | |
Reference
| Z. Naturforsch. 35b, 594—598 (1980); eingegangen am 5. Dezember 1979 | | | |
Published
| 1980 | | | |
Keywords
| Organometal Phosphines, Dicarbonyl-nitrosyl Cobalt Complexes, NMR Spectra | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/35/ZNB-1980-35b-0594.pdf | | | | Identifier
| ZNB-1980-35b-0594 | | | | Volume
| 35 | |
| 6 | Author
| Werner Zeiß, Wolfgang Schwarz, Heinz Hess | Requires cookie* | | | Title
| 995 | | | | Abstract
| W. Zeiß et al. • (MePNMe)4S3, ein Cyclotetra(A 3 ,A 5 ,A 5 ,A 5 -phosphazan) (MePNMe)4S3, a Cyclotetra(A 3 ,A 5 ,A 5 ,A 5 -phosphazane) 31 P} Decoupling Octamethylcyclotetra(A 3 -phosphazane) (1) reacts with three mole equivalents of sulfur, added either in excess or in deficite, to give 2, the first cyclotetra(A 3 ,A 5 ,A 5 ,A 5 -phosphazane). Its crystal structure determination shows a completely unsymmetrical molecule, which does not undergo ring inversion in solution. Thus an ABMX spin system with remarkably different AM and BM coupling constants is observed in the 31 P{ 1 H} NMR spectrum. By means of selective { 31 P} decoupling, all CH3 proton signals could be assigned in the 1 H NMR spectrum. | | | |
Reference
| Z. Naturforsch. 35b, 959—963 (1980); eingegangen am 29. Februar 1980 | | | |
Published
| 1980 | | | |
Keywords
| Cyclotetraphosphazane, Crystal Structure, NMR Spectra, Selective { | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/35/ZNB-1980-35b-0959.pdf | | | | Identifier
| ZNB-1980-35b-0959 | | | | Volume
| 35 | |
| 8 | Author
| Ertugrul Arpac, Lutz Dahlenburg | Requires cookie* | | | Title
| Oligophosphin-Liganden, I | | | | Abstract
| Einfache Synthesen der trimethylenverknüpften Triphosphine RP[(CH2)3PPh2]2 und ihrer Vorstufen Ph2P(CH2)3P(H)R (R Ph, Me) Oligophosphine Ligands, I Convenient Syntheses of the Trimethylene-linked Triphosphines RP[(CH2)3PPh2]2 and their Precursors Ph2P(CH2)3P(H)R (R = Ph, Me) The secondary-tertiary diphosphines Ph2P(CH2)3P(H)Ph (2) and Ph2P(CH2)3P(H)Me (3) have been prepared from Ph2P(CH2)3Cl (1) and NaP(H)Ph or LiP(H)Me, respectively. Metallation of 2 and 3 with n-butyl lithium and further reaction of the lithio-derivatives with one equivalent of 1 yields PhP[(CH2)3PPh2]2 (4) and MeP[(CH2)3PPh2]2 (5). The tritertiary phosphines 4 and 5 have likewise been obtained from RPLi2 (R = Ph, Me) and two equivalents of 1. The synthesis of 4 from PhPCl2 and two equivalents of the Grignard reagent of 1 is also reported. Each of the phosphines 1-5 was characterized by NMR and mass spectroscopy. | | | |
Reference
| Z. Naturforsch. 35b, 146—152 (1980); eingegangen am 26. Oktober 1979 | | | |
Published
| 1980 | | | |
Keywords
| Secondary-tertiary Diphosphines, Tritertiary Phosphines, Preparation, NMR Spectra, Mass Spectra | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/35/ZNB-1980-35b-0146.pdf | | | | Identifier
| ZNB-1980-35b-0146 | | | | Volume
| 35 | |
| 9 | Author
| Herbert Schumann, Manfred Meissner | Requires cookie* | | | Title
| Organometallphosphin-substituierte Übergangsmetallkomplexe, XXVII [1] Trinitrosyl-organometallphosphin-mangan-Komplexe Organometalphosphine-Substituted Transition Metal Complexes, XXVII [1] Trinitrosy 1 (organometalphosphine)manganese Complexes | | | | Abstract
| The reactions of carbonyl trinitrosyl manganese with tri-ferf-butylphosphine, di-(ter£-butyl)-trimethylsilyl-, -germyl-, -stannyl-phosphine, fer£-butyl-bis(trimethylsilyl)-, -(germyl)-, -(stannyl)-phosphine, as well as with tris(trimethylsilyl)-, -(germyl)-, and -(stannyl)phosphine result in the elimination of the CO ligand and the formation of corresponding trinitrosyl(organometalphosphine)manganese complexes. The IR, UV, 1 H, 31 P, and 55 Mn NMR spectra are reported and discussed. | | | |
Reference
| Z. Naturforsch. 35b, 863—868 (1980); eingegangen am 7. März 1980 | | | |
Published
| 1980 | | | |
Keywords
| Nitrosyl(organometalphosphine)manganese Complexes Organometal Phosphines, Trinitrosyl Manganese Complexes, NMR Spectra | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/35/ZNB-1980-35b-0863.pdf | | | | Identifier
| ZNB-1980-35b-0863 | | | | Volume
| 35 | |
| 10 | Author
| H. S. Sangari, G. S. Sodhi, N. K. Kaushik, R. P. Singh | Requires cookie* | | | Title
| Bis(?? 5 -cyclopentacüenyl)N,N-Disiibstituted Dithiocarbamato(cUoro)oxomolybdeniim(VI) Complexes | | | | Abstract
| Bis(?j 5 -cyclopentadienyl)N,N-disubstituted Dithiocarbamato(chloro)oxomolybdenum(VI) complexes of the type (C5H5)2MoO(S2CNR2)C1 and (CsHshMoO^CNRR'JCl where R = Me, Et, «'-Pr and R' = cyclohexyl (cyhx) have been prepared by the reaction of stoichio- metric amounts of bis(^5-cyclopentadienyl)oxomolybdenum(VI) dichloride with sodium dichio-thiocarbamates in refluxing dichloromethane. Infrared spectral studies demonstrate that in these complexes, the dithiocarbamate ligands are bidentate. Hence a coordination number of 7 may be assigned to the molybdenum(VI) atom in each case. In addition to infrared studies, electronic spectra, NMR studies, magnetic susceptibility, elemental analyses and conductance measurements have been carried out for these complexes. | | | |
Reference
| Z. Naturforsch. 35b, 1254—1256 (1980); received May 9 1980 | | | |
Published
| 1980 | | | |
Keywords
| Complexes, Electrical Conductance, Magnetic Susceptibility, Electronic Spectra, NMR Spectra | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/35/ZNB-1980-35b-1254.pdf | | | | Identifier
| ZNB-1980-35b-1254 | | | | Volume
| 35 | |
| 12 | Author
| R. B. Materikova, V. N. Babin, S. P. Solodovnikov, I. R. Lyatifov, P. V. Petrovsky, E. I. Fedin | Requires cookie* | | | Title
| Salts of Ferricinium Cation and its Homologues: NMR Investigation, II EPR and NMR Spectra of sym-Polymethyl Substituted Ferricinium Cations | | | | Abstract
| The EPR, iH and 13 C NMR spectra of methylferricinium hexafluorophosphates, [(MenCp)2Fe]PFö, n — 0-5, have been recorded. HFS constants have been estimated for all the ligand atoms. The general pattern of the spin density distribution is shown to depend on the superposition of the various mechanisms of spin derealization. For the majority of the cations the determining factors has been found to be represented by spin polarization over the jr-skeleton. | | | |
Reference
| Z. Naturforsch. 35b, 1415—1419 (1980); received June 2 1980 | | | |
Published
| 1980 | | | |
Keywords
| Ferricinium, sym-Polymethylferricinium, Spin Derealization, NMR Spectra, ERR Spectra | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/35/ZNB-1980-35b-1415.pdf | | | | Identifier
| ZNB-1980-35b-1415 | | | | Volume
| 35 | |
| 14 | Author
| Othmar Stelzer, Norbert Weferling | Requires cookie* | | | Title
| Reaktionen koordinierter Liganden, VI [1] Substituenteneinflüsse bei der Bildung von Tri-und Tetraphosphinen in der Koordinationssphäre von Übergangsmetallen Reactions of Coordinated Ligands, VI [1] Influence of Substituents on the Formation of Tri-and Tetraphosphines in the Coordination Sphere of Transition Metals | | | | Abstract
| The lithiumphosphido complex cis-Mo(CO)4(Me2PLi)2 reacts with dichlorophosphines RPCI2 (R = Ph, Bu') to give coordination compounds of tetraphosphines Me2P-PR-PR-PMe2, whereas the complex of the triphosphine eis -Mo (CO)4 (Ph2P-PMe-PPh2) is obtained starting with the lithiumphosphido complex cis-Mo(CO)4(Ph2PLi)2. Phenyldilithiumphosphine and the chlorophosphine complexes cis-Mo(CO)4(R2PCl)2 (R = Me, Ph) give in low yield cis-Mo(CO)4(R2P-PPh-PPh-PR2) and cis-Mo(CO)4(R2P-PPh-PR2). The mechanisms of these reactions are discussed. The {3ippjj-and { 1 H} 31 P-NMR spectra are analysed and correlated with the structures of these complexes. | | | |
Reference
| (Z. Naturforsch. 35b, 74—81 [1980]; eingegangen am 13. Juni 1979) | | | |
Published
| 1980 | | | |
Keywords
| Lithiumphosphido Complexes, Tri-and Tetraphosphine Complexes, Halogen-Metal Exchange, NMR Spectra | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/35/ZNB-1980-35b-0074.pdf | | | | Identifier
| ZNB-1980-35b-0074 | | | | Volume
| 35 | |
| 16 | Author
| Nicholas Bodor, JamesJ. Kaminski, S. D. Worley, StevenH. Gerson, N. J. | Requires cookie* | | | Title
| Quantitative Evaluation of the Reactivity of Alkylating Agents | | | | Abstract
| A sensitive and reproducible method for quantitative evaluation of the relative reactivities of alkylating agents was developed, based on competitve alkylation. The method is superior to the known colorimetric methods. The reactivities of the agents could also be correlated with the 13 C chemical shifts of the a-methylene. The method was successfully applied for the ranking of "soft" alkylating agents of low reactivity. It was recently found that "soft" alkylating RI | | | |
Reference
| Z. Naturforsch. 35b, 758—763 (1980); received February 4 1980 | | | |
Published
| 1980 | | | |
Keywords
| Alkylating Agents, Soft Drugs, NMR Spectra, Competitive Alkylation, Soft Quaternary Salts | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/35/ZNB-1980-35b-0758.pdf | | | | Identifier
| ZNB-1980-35b-0758 | | | | Volume
| 35 | |
|
