| | 1 | Author
| Jochen Ellermann3, Martin Schütz3, FrankW. Heinemann3, Matthias Moll3, Walter Bauerb | Requires cookie* | | | Title
| Chemie polyfunktioneller Moleküle, 127 [1] PPh2-Eliminierung aus dem PP-verknüpften Phosphazen Ph2P-N=PPh2-PPh2=N-PPh2 mit [C5H5Fe(CO)(/x-CO)]2; Kristallstrukturanalyse des Phosphazen-Derivats Chemistry of Polyfunctional Molecules, 127 [1] PPh2 Elimination from the PP Connected Phosphazene Ph2P-N=PPh2-PPh2=N-PPh-, with [C5H5Fe(CO)(^-CO)]2; Crystal Structure of the Phosphazene Derivative  | | | | Abstract
| The reaction of Ph2P-N=PPh2-PPh2=N-PPh2 (Ph = C6H5, 2) with [CpFe(CO)(^-CO)]2 (Cp = C5H5, 3) yields under elimination of a PPh2-group from 2 and cleavage of the Fe-Fe bond in 3 the monocyclic ferraphosphazene complex Cp(OC)Fe-Ph2P-N=PPh2=N-PPh2 (4) and Ph2P-PPh2 (5). In a side reaction the P-P bond of 2 is also cleaved in a redox process to give Cp(OC)Fe-Ph2P-N-PPh2 (7). Compound 4 has been characterized by a crystal structure determination. | | | |
Reference
| Z. Naturforsch. 52b, 795—800 (1997); eingegangen am 7. April 1997 | | | |
Published
| 1997 | | | |
Keywords
| Phosphazene, Iron Complexes, X-Ray, Elimination of PPh2, Cleavage of PP | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/52/ZNB-1997-52b-0795.pdf | | | | Identifier
| ZNB-1997-52b-0795 | | | | Volume
| 52 | |
|
