| 1 | Author
| Jochen Ellermann, Peter Gabold, FalkA. Knoch, MatthiasM. Oll, Astrid Schmidt, Martin Schütz | Requires cookie* | | Title
| Chemie polyfunktioneller Moleküle, 120 [1] Synthesen und Kristallstrukturanalysen von Tris(imido-tetraphenyl- diphosphinato-0,0')eisen(III) und des PP-verknüpften Phosphazens Ph2P-N=PPh2-PPh2=N-PPh2 Chemistry o f Polyfunctional M olecules, 120 [11 Syntheses and Crystal Structures o f Tris(imido-tetraphenyl-diphosphinato-0,0')iron(III) and o f the PP-Connected Phosphazene Ph2P-N=PPh2-PPh2=N-PPh2  | | | Abstract
| While the reaction of anhydrous iron(III) chloride with the chelate ligand [(C6H5)2P(0)]2NH (6) is an efficient way to synthesize the new tricyclic compound imido-tetraphenyl-diphosphinato-0,0'iron(III), [Fe{0-P(Ph2)=N-P(Ph2)= 0 }3] (4), treatment of [(C6H5)2P]2NLi (1) with anhydrous iron(III) fluoride in THF represents a simple route to obtain the phosphorus-phosphorus connected species Ph2P-N=PPh2-PPh2=N-PPh2(7). Both compounds were charac terized by X-ray crystallography, 'H ,31 P {1H}, 13C {1H} NMR, IR, Raman and mass spectra. | | |
Reference
| Z. Naturforsch. 51b, 201—208 (1996); eingegangen am 24. Juli 1995 | | |
Published
| 1996 | | |
Keywords
| Phosphazene, Iron Complexes, Synthesis, X-Ray | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/51/ZNB-1996-51b-0201.pdf | | | Identifier
| ZNB-1996-51b-0201 | | | Volume
| 51 | |
|