| | 1 | Author
| ErnstOtto Fischer, Willi Kleine, Werner Schambeck, Ulrich Schubert | Requires cookie* | | | Title
| Übergangsmetall-Garben-Komplexe, CXXI [1] Fluorcarbenkomplexe des Mangans Transition Metal Car bene Complexes, CXXI [1] Fluorocarbene Complexes of Manganese  | | | | Abstract
| The reaction between CH3CsH4Mn(C0)3 and LiN(C2Hs)2 and subsequent alkylation with [(C 2 H 5)30]BF4 affords CH 3 C5H4(CO)2MnC(OC2H5)N(C2H5)2. This carbene complex reacts with borontrihalides BX 3 (X = F, Cl) to yield [CH 3 C5H4(C0)2MnCN(C2H 5)2]BX 4 . Ad-dition of [(C 4 H 9) 4 N]F to this cationic carbyne complex results in the formation of CH3C5H4(CO)2MnC(F)N(C2H5) 2 . In the same way C 5 H5(C0)2MnC(F)C 6 H5 is prepared from [CsH^CO^MnCCeHslSbClß. Fluoride addition can be reversed by reaction of the latter carbene complex with BF3 to give [CsH5(CO)2MnCC6H5]BF4. In the X-ray structure of C5H5(C0)2MnC(F)C6H5 unusual bonding parameters are found, which are consistent with the easy cleavage of the C(carbene)-F bond. | | | |
Reference
| Z. Naturforsch. 36b, 1575—1579 (1981); eingegangen am 21. Juli 1981 | | | |
Published
| 1981 | | | |
Keywords
| Cationic Carbyne Complexes, Fluorcarbene Complexes, Fluoride Abstraction, X-ray | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/36/ZNB-1981-36b-1575.pdf | | | | Identifier
| ZNB-1981-36b-1575 | | | | Volume
| 36 | |
|
