| | 1 | Author
| Henri Brunner, Jean-Claude Leblanc | Requires cookie* | | | Title
| (CH2OCH3)P(C6H5)2N(CH3)R * mit chiralen Fe-Atomen Optically Active Transition Metal Complexes, LXX [1] Preparation of the Optically Active Diastereoisomers CsHsFe^O)- (CH2OCH3)P(C6H5)2N(CH3)R* with Chiral Fe Atoms  | | | | Abstract
| The two diastereoisomers CsHsFe(CO)(CH2OCH3)P(CeHs)2N(CH3)R* (Ba, b), with R* = 0S)-CH(CH3)(C6H5), differing only in the Fe configuration, have been obtained by photochemical reaction of C5H5Fe(C0)2CH20CH3 with (£)-(+)-P(C6H5)2N(CH3)R*. The optically pure isomer 3 a can be isolated by chromatography at low temperature; its chiroptical properties are discussed. | | | |
Reference
| Z. Naturforsch. 35b, 1491—1493 (1980); eingegangen am 8. August 1980 | | | |
Published
| 1980 | | | |
Keywords
| Diastereoisomers, Fe-Configuration, Separation, CD Spectra | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/35/ZNB-1980-35b-1491_n.pdf | | | | Identifier
| ZNB-1980-35b-1491_n | | | | Volume
| 35 | |
|
