| 1 | Author
| Martin Hoch, Dieter Rehder | Requires cookie* | | Title
| Carbonylniobium Chemistry, IV [1] Derivatives of ^ 5 -C5H5Nb(CO)4 with Tridentate Phosphines  | | | Abstract
| The photo-induced reaction between CpNb(CO)4 and Ph2P(CH2)2PR(CH2)2PPh2 (L; R = Ph, Cy) yields the chelated five-membered ring complexes cis-[CpNb(CO)2L] (two isomers in the case of R = Cy). The uncordinated PPI12 group reacts with CpNb(CO)3THF to form CpNb(CO)2(ia-L)CpNb(CO)3. IR, 31 P and 93 Nb NMR spectra are discussed and compared with corresponding data of the analogous vanadium complexes. | | |
Reference
| Z. Naturforsch. 38b, 446—448 (1983); received December 17 1982 | | |
Published
| 1983 | | |
Keywords
| Carbonylniobium, 1, 4, 7-Triphosphaheptanes, 31 P NMR, 93 Nb NMR | | |
Similar Items
| Find | | DEBUG INFO
| | | | TEI-XML for
| default:Reihe_B/38/ZNB-1983-38b-0446.pdf | | | Identifier
| ZNB-1983-38b-0446 | | | Volume
| 38 | |
|