| | 1 | Author
| Hans-Dieter Eßwein, Günter Häfelinger | Requires cookie* | | | Title
| Bestimmung von Ringstromanisotropieeffekten im 1 H-NMR -Spektrum von 9-Phenylderivaten des 1.4-Dimethylanthracens und 1.4-Dimethyltriptycens Determination of Ring Current Anisotropy Effects in the X H NMR Spectra of 9-Phenyl Derivatives of 1,4-Dimethylanthracene and 1,4-Dimethyltriptycene  | | | |
Reference
| Z. Naturforsch. 33b, 1026—1032 (1978); eingegangen am 31. Mai 1978 | | | |
Published
| 1978 | | | |
Keywords
| Ring Current, Anisotropy Effects, 1 H NMR, 9-Phenyl Derivatives, 14-Dimethylanthracene, 1, 4-Dimethyltriptycene | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/33/ZNB-1978-33b-1026.pdf | | | | Identifier
| ZNB-1978-33b-1026 | | | | Volume
| 33 | |
| 2 | Author
| Henri Brunner, Heinz Vogt | Requires cookie* | | | Title
| Optically Active Transition Metal Complexes, LIX [1] | | | | Abstract
| The pair of diastereoisomers (+)436-and (—)436-C5H5Fe(CO)(COCH3)P02R*, with P02R* = (S)-(+)-(C6H5)2PN(CH3)CH(CH3)(C6H5), can be separated into its components by preparative liquid chromatography under pressure. On heating (+)436-C5H5Fe(CO)-(COCH3)P02R* equilibrates with C5H5Fe(CO)2CH3 and P02R* before epimerization at the Fe [atom takes place. In the same way, the equilibrium C5H5Fe(CO)(COCH3)P(C6Hs)3 C5H5Fe(CO)2CH3 + P(C6Hs)3 can be obtained starting from either side. It is shown that the decarbonylation C5H5Fe(CO)(COCH3)P(C6H5)3 C5H5Fe(CO)(CH3)P(C6H5)3 + CO is not a thermal but a photochemical reaction. | | | |
Reference
| Z. Naturforsch. 33b, 1231—234 (1978); eingegangen am 6. Juli 1978 | | | |
Published
| 1978 | | | |
Keywords
| Diastereoisomer Separation, Preparative Liquid Chromatography, 1 H NMR, Optical Activity, Transition Metal Complexes | | | |
Similar Items
| Find | | | DEBUG INFO
| | | | | TEI-XML for
| default:Reihe_B/33/ZNB-1978-33b-1231.pdf | | | | Identifier
| ZNB-1978-33b-1231 | | | | Volume
| 33 | |
|
